C15H23ClN2O4 — CID 20660285
ethyl (2S)-2-[[(3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]propanoate;hydrochloride (PubChem CID 20660285) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is ethyl (2S)-2-[[(3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]propanoate;hydrochloride.
| Compound Name | ethyl (2S)-2-[[(3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 20660285 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | ethyl (2S)-2-[[(3R)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](C)NC(=O)C(O)[C@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-3-21-15(20)10(2)17-14(19)13(18)12(16)9-11-7-5-4-6-8-11;/h4-8,10,12-13,18H,3,9,16H2,1-2H3,(H,17,19);1H/t10-,12+,13?;/m0./s1 |
| InChIKey | DRYVKJFZBNCGOY-NCSLVQLLSA-N |
| XLogP | 0.41 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |