C16H25ClN2O4S — CID 70132168
ethyl 2-[[(2S)-3-amino-4-benzylsulfanyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride (PubChem CID 70132168) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is ethyl 2-[[(2S)-3-amino-4-benzylsulfanyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride.
| Compound Name | ethyl 2-[[(2S)-3-amino-4-benzylsulfanyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 70132168 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethyl 2-[[(2S)-3-amino-4-benzylsulfanyl-2-hydroxybutanoyl]amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)NC(=O)[C@@H](O)C(N)CSCc1ccccc1.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-3-22-16(21)11(2)18-15(20)14(19)13(17)10-23-9-12-7-5-4-6-8-12;/h4-8,11,13-14,19H,3,9-10,17H2,1-2H3,(H,18,20);1H/t11?,13?,14-;/m0./s1 |
| InChIKey | CHEKPFCLGTWYEF-JOOYLYHMSA-N |
| XLogP | 1.10 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |