C22H27NO4S — CID 57220112
ethyl 3-benzylsulfanyl-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]propanoate (PubChem CID 57220112) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 3-benzylsulfanyl-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]propanoate.
| Compound Name | ethyl 3-benzylsulfanyl-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 57220112 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 3-benzylsulfanyl-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]propanoate |
| SMILES | CCOC(=O)C(CSCc1ccccc1)N[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4S/c1-3-26-22(25)20(16-28-15-19-12-8-5-9-13-19)23-17(2)21(24)27-14-18-10-6-4-7-11-18/h4-13,17,20,23H,3,14-16H2,1-2H3/t17-,20?/m0/s1 |
| InChIKey | NFGNDNRNHXXSOB-DIMJTDRSSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |