C18H27NO4 — CID 18597312
benzyl (2S)-2-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]-4-methylpentanoate (PubChem CID 18597312) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 18597312 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | benzyl (2S)-2-[[(2R)-1-ethoxy-1-oxopropan-2-yl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)[C@@H](C)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO4/c1-5-22-17(20)14(4)19-16(11-13(2)3)18(21)23-12-15-9-7-6-8-10-15/h6-10,13-14,16,19H,5,11-12H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | FKLVTORQWNOLNY-ZBFHGGJFSA-N |
| XLogP | 2.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |