C24H35NO9 — CID 157334965
(Z)-but-2-enedioic acid;ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate;propan-2-one (PubChem CID 157334965) has the molecular formula C24H35NO9 and a molecular weight of 481.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate;propan-2-one.
| Compound Name | (Z)-but-2-enedioic acid;ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate;propan-2-one |
|---|---|
| PubChem CID | 157334965 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate;propan-2-one |
| SMILES | CC(C)=O.CCC[C@H](N[C@@H](C)C(=O)OCc1ccccc1)C(=O)OCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H25NO4.C4H4O4.C3H6O/c1-4-9-15(17(20)21-5-2)18-13(3)16(19)22-12-14-10-7-6-8-11-14;5-3(6)1-2-4(7)8;1-3(2)4/h6-8,10-11,13,15,18H,4-5,9,12H2,1-3H3;1-2H,(H,5,6)(H,7,8);1-2H3/b;2-1-;/t13-,15-;;/m0../s1 |
| InChIKey | VWYPXEALQRVPEO-FJDBZZPRSA-N |
| XLogP | 2.75 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|