C25H30F3NO7S — CID 91316362
benzyl 2-[[1-ethoxy-1-oxo-3-[4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate (PubChem CID 91316362) has the molecular formula C25H30F3NO7S and a molecular weight of 545.58 g/mol. Its IUPAC name is benzyl 2-[[1-ethoxy-1-oxo-3-[4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate.
| Compound Name | benzyl 2-[[1-ethoxy-1-oxo-3-[4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 91316362 |
| Molecular Formula | C25H30F3NO7S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | benzyl 2-[[1-ethoxy-1-oxo-3-[4-(trifluoromethylsulfonyloxy)phenyl]propan-2-yl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)NC(CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H30F3NO7S/c1-4-34-23(30)22(15-18-10-12-20(13-11-18)36-37(32,33)25(26,27)28)29-21(14-17(2)3)24(31)35-16-19-8-6-5-7-9-19/h5-13,17,21-22,29H,4,14-16H2,1-3H3 |
| InChIKey | FZYXPYDIZNVCEV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|