C22H24F3NO7S — CID 14560582
benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 14560582) has the molecular formula C22H24F3NO7S and a molecular weight of 503.50 g/mol. Its IUPAC name is benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 14560582 |
| Molecular Formula | C22H24F3NO7S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24F3NO7S/c1-21(2,3)32-20(28)26-18(19(27)31-14-16-7-5-4-6-8-16)13-15-9-11-17(12-10-15)33-34(29,30)22(23,24)25/h4-12,18H,13-14H2,1-3H3,(H,26,28) |
| InChIKey | MJRWUONHVHPKFK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|