C15H20F3N3O6S — CID 146470425
[4-[(3Z)-3-amino-3-hydroxyimino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate (PubChem CID 146470425) has the molecular formula C15H20F3N3O6S and a molecular weight of 427.40 g/mol. Its IUPAC name is [4-[(3Z)-3-amino-3-hydroxyimino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(3Z)-3-amino-3-hydroxyimino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146470425 |
| Molecular Formula | C15H20F3N3O6S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [4-[(3Z)-3-amino-3-hydroxyimino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)/C(N)=N/O |
| InChI | InChI=1S/C15H20F3N3O6S/c1-14(2,3)26-13(22)20-11(12(19)21-23)8-9-4-6-10(7-5-9)27-28(24,25)15(16,17)18/h4-7,11,23H,8H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | CIXUGCUUDFBRMV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|