C15H18F3NO6S — CID 130358233
[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate (PubChem CID 130358233) has the molecular formula C15H18F3NO6S and a molecular weight of 397.37 g/mol. Its IUPAC name is [4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130358233 |
| Molecular Formula | C15H18F3NO6S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C=O)Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO6S/c1-14(2,3)24-13(21)19-11(9-20)8-10-4-6-12(7-5-10)25-26(22,23)15(16,17)18/h4-7,9,11H,8H2,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | BZHXDDANMUCUDS-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|