C15H22N4O3 — CID 22876444
tert-butyl N-[(2S)-1-[4-(diaminomethylideneamino)phenyl]-3-oxopropan-2-yl]carbamate (PubChem CID 22876444) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-(diaminomethylideneamino)phenyl]-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-(diaminomethylideneamino)phenyl]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22876444 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-(diaminomethylideneamino)phenyl]-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=O)Cc1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C15H22N4O3/c1-15(2,3)22-14(21)19-12(9-20)8-10-4-6-11(7-5-10)18-13(16)17/h4-7,9,12H,8H2,1-3H3,(H,19,21)(H4,16,17,18)/t12-/m0/s1 |
| InChIKey | GPKWDFGPGGKAJM-LBPRGKRZSA-N |
| XLogP | 1.23 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|