C16H24N6O4 — CID 168603760
3-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 168603760) has the molecular formula C16H24N6O4 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 168603760 |
| Molecular Formula | C16H24N6O4 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(/N=C(\N)N=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C16H24N6O4/c1-16(2,3)26-15(25)21-11(12(23)24)8-9-4-6-10(7-5-9)20-14(19)22-13(17)18/h4-7,11H,8H2,1-3H3,(H,21,25)(H,23,24)(H6,17,18,19,20,22) |
| InChIKey | SZQDGKHREIVNRX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|