C13H19N3O3 — CID 88578728
tert-butyl N-[(2S)-1-(5-amino-2-pyridinyl)-3-oxopropan-2-yl]carbamate (PubChem CID 88578728) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(5-amino-2-pyridinyl)-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(5-amino-2-pyridinyl)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88578728 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-(5-amino-2-pyridinyl)-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=O)Cc1ccc(N)cn1 |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)19-12(18)16-11(8-17)6-10-5-4-9(14)7-15-10/h4-5,7-8,11H,6,14H2,1-3H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | GLQVCTOXNVLXRR-NSHDSACASA-N |
| XLogP | 1.30 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|