C10H15N5O3 — CID 170231767
tert-butyl N-[(2S)-1-oxo-3-(1,2,4,5-tetrazin-3-yl)propan-2-yl]carbamate (PubChem CID 170231767) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-3-(1,2,4,5-tetrazin-3-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-3-(1,2,4,5-tetrazin-3-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170231767 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-3-(1,2,4,5-tetrazin-3-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=O)Cc1nncnn1 |
| InChI | InChI=1S/C10H15N5O3/c1-10(2,3)18-9(17)13-7(5-16)4-8-14-11-6-12-15-8/h5-7H,4H2,1-3H3,(H,13,17)/t7-/m0/s1 |
| InChIKey | ZXJNHFCOPBJPSF-ZETCQYMHSA-N |
| XLogP | -0.10 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|