C26H27NO5 — CID 91581048
tert-butyl N-[(2S)-1-oxo-3-[4-(4-phenoxyphenoxy)phenyl]propan-2-yl]carbamate (PubChem CID 91581048) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-3-[4-(4-phenoxyphenoxy)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-3-[4-(4-phenoxyphenoxy)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 91581048 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-3-[4-(4-phenoxyphenoxy)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=O)Cc1ccc(Oc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-26(2,3)32-25(29)27-20(18-28)17-19-9-11-22(12-10-19)31-24-15-13-23(14-16-24)30-21-7-5-4-6-8-21/h4-16,18,20H,17H2,1-3H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | KBXMJKQJVABBQI-FQEVSTJZSA-N |
| XLogP | 5.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|