C13H21NO4 — CID 20501491
tert-butyl N-[1-(3,6-dihydro-2H-pyran-5-yl)-3-oxopropan-2-yl]carbamate (PubChem CID 20501491) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl N-[1-(3,6-dihydro-2H-pyran-5-yl)-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,6-dihydro-2H-pyran-5-yl)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 20501491 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl N-[1-(3,6-dihydro-2H-pyran-5-yl)-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)CC1=CCCOC1 |
| InChI | InChI=1S/C13H21NO4/c1-13(2,3)18-12(16)14-11(8-15)7-10-5-4-6-17-9-10/h5,8,11H,4,6-7,9H2,1-3H3,(H,14,16) |
| InChIKey | HMIKBXLJBGHZIS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|