C14H21BN2O6 — CID 123302805
[6-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3-pyridinyl]boronic acid (PubChem CID 123302805) has the molecular formula C14H21BN2O6 and a molecular weight of 324.14 g/mol. Its IUPAC name is [6-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 123302805 |
| Molecular Formula | C14H21BN2O6 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [6-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3-pyridinyl]boronic acid |
| SMILES | COC(=O)[C@H](Cc1ccc(B(O)O)cn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21BN2O6/c1-14(2,3)23-13(19)17-11(12(18)22-4)7-10-6-5-9(8-16-10)15(20)21/h5-6,8,11,20-21H,7H2,1-4H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | AGYQCKWRCWXBRP-NSHDSACASA-N |
| XLogP | -0.63 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|