C21H37N4O5P — CID 136658956
tert-butyl N-[N'-[4-(2-amino-2-dimethylphosphorylethyl)phenyl]carbamimidoyl]carbamate;tert-butyl formate (PubChem CID 136658956) has the molecular formula C21H37N4O5P and a molecular weight of 456.52 g/mol. Its IUPAC name is tert-butyl N-[N'-[4-(2-amino-2-dimethylphosphorylethyl)phenyl]carbamimidoyl]carbamate;tert-butyl formate.
| Compound Name | tert-butyl N-[N'-[4-(2-amino-2-dimethylphosphorylethyl)phenyl]carbamimidoyl]carbamate;tert-butyl formate |
|---|---|
| PubChem CID | 136658956 |
| Molecular Formula | C21H37N4O5P |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | tert-butyl N-[N'-[4-(2-amino-2-dimethylphosphorylethyl)phenyl]carbamimidoyl]carbamate;tert-butyl formate |
| SMILES | CC(C)(C)OC(=O)N/C(N)=N/c1ccc(CC(N)P(C)(C)=O)cc1.CC(C)(C)OC=O |
| InChI | InChI=1S/C16H27N4O3P.C5H10O2/c1-16(2,3)23-15(21)20-14(18)19-12-8-6-11(7-9-12)10-13(17)24(4,5)22;1-5(2,3)7-4-6/h6-9,13H,10,17H2,1-5H3,(H3,18,19,20,21);4H,1-3H3 |
| InChIKey | JIQLFQOEVPKSKH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|