C26H28N6O4 — CID 135909466
ethyl N-[N'-[4-[4-[4-[[amino-(ethoxycarbonylamino)methylidene]amino]phenyl]phenyl]phenyl]carbamimidoyl]carbamate (PubChem CID 135909466) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is ethyl N-[N'-[4-[4-[4-[[amino-(ethoxycarbonylamino)methylidene]amino]phenyl]phenyl]phenyl]carbamimidoyl]carbamate.
| Compound Name | ethyl N-[N'-[4-[4-[4-[[amino-(ethoxycarbonylamino)methylidene]amino]phenyl]phenyl]phenyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135909466 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | ethyl N-[N'-[4-[4-[4-[[amino-(ethoxycarbonylamino)methylidene]amino]phenyl]phenyl]phenyl]carbamimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(N)=N/c1ccc(-c2ccc(-c3ccc(/N=C(\N)NC(=O)OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H28N6O4/c1-3-35-25(33)31-23(27)29-21-13-9-19(10-14-21)17-5-7-18(8-6-17)20-11-15-22(16-12-20)30-24(28)32-26(34)36-4-2/h5-16H,3-4H2,1-2H3,(H3,27,29,31,33)(H3,28,30,32,34) |
| InChIKey | ZNPYZYMARFLZJV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|