C18H20N4O2S — CID 5134886
ethyl N-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamothioyl]carbamate (PubChem CID 5134886) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is ethyl N-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 5134886 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | ethyl N-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1ccc(C)cc1/N=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20N4O2S/c1-4-24-18(23)20-17(25)19-15-10-7-13(3)11-16(15)22-21-14-8-5-12(2)6-9-14/h5-11H,4H2,1-3H3,(H2,19,20,23,25)/b22-21+ |
| InChIKey | GQTWIOVTTONPMB-QURGRASLSA-N |
| XLogP | 5.16 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|