C42H36N6O3 — CID 2852723
N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-4-[4-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]phenoxy]benzamide (PubChem CID 2852723) has the molecular formula C42H36N6O3 and a molecular weight of 672.79 g/mol. Its IUPAC name is N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-4-[4-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]phenoxy]benzamide.
| Compound Name | N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-4-[4-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 2852723 |
| Molecular Formula | C42H36N6O3 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | N-[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]-4-[4-[[4-methyl-2-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]phenoxy]benzamide |
| SMILES | Cc1ccc(/N=N/c2cc(C)ccc2NC(=O)c2ccc(Oc3ccc(C(=O)Nc4ccc(C)cc4/N=N/c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H36N6O3/c1-27-5-15-33(16-6-27)45-47-39-25-29(3)9-23-37(39)43-41(49)31-11-19-35(20-12-31)51-36-21-13-32(14-22-36)42(50)44-38-24-10-30(4)26-40(38)48-46-34-17-7-28(2)8-18-34/h5-26H,1-4H3,(H,43,49)(H,44,50)/b47-45+,48-46+ |
| InChIKey | RZFKSZXHLSPBFA-MLGMXDONSA-N |
| XLogP | 12.05 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|