C19H23N3O — CID 135440609
N-[N'-(4-tert-butylphenyl)carbamimidoyl]-4-methylbenzamide (PubChem CID 135440609) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[N'-(4-tert-butylphenyl)carbamimidoyl]-4-methylbenzamide.
| Compound Name | N-[N'-(4-tert-butylphenyl)carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 135440609 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[N'-(4-tert-butylphenyl)carbamimidoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(N)=N/c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-13-5-7-14(8-6-13)17(23)22-18(20)21-16-11-9-15(10-12-16)19(2,3)4/h5-12H,1-4H3,(H3,20,21,22,23) |
| InChIKey | ADVFDEDGWRJDRN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|