C18H19Cl2N3O — CID 135960418
N-[N'-(4-tert-butylphenyl)carbamimidoyl]-2,5-dichlorobenzamide (PubChem CID 135960418) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[N'-(4-tert-butylphenyl)carbamimidoyl]-2,5-dichlorobenzamide.
| Compound Name | N-[N'-(4-tert-butylphenyl)carbamimidoyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 135960418 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[N'-(4-tert-butylphenyl)carbamimidoyl]-2,5-dichlorobenzamide |
| SMILES | CC(C)(C)c1ccc(/N=C(\N)NC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O/c1-18(2,3)11-4-7-13(8-5-11)22-17(21)23-16(24)14-10-12(19)6-9-15(14)20/h4-10H,1-3H3,(H3,21,22,23,24) |
| InChIKey | MERWBUYWXDTQQQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|