C20H22Cl2N2O — CID 3681131
4-tert-butyl-N-[1-(2,4-dichlorophenyl)propylideneamino]benzamide (PubChem CID 3681131) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.32 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(2,4-dichlorophenyl)propylideneamino]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(2,4-dichlorophenyl)propylideneamino]benzamide |
|---|---|
| PubChem CID | 3681131 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-tert-butyl-N-[1-(2,4-dichlorophenyl)propylideneamino]benzamide |
| SMILES | CCC(=NNC(=O)c1ccc(C(C)(C)C)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O/c1-5-18(16-11-10-15(21)12-17(16)22)23-24-19(25)13-6-8-14(9-7-13)20(2,3)4/h6-12H,5H2,1-4H3,(H,24,25) |
| InChIKey | SIUJSXXAISKIHF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|