C16H13Cl3N2O — CID 4063120
2,4-dichloro-N-[1-(4-chlorophenyl)propylideneamino]benzamide (PubChem CID 4063120) has the molecular formula C16H13Cl3N2O and a molecular weight of 355.65 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(4-chlorophenyl)propylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(4-chlorophenyl)propylideneamino]benzamide |
|---|---|
| PubChem CID | 4063120 |
| Molecular Formula | C16H13Cl3N2O |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2,4-dichloro-N-[1-(4-chlorophenyl)propylideneamino]benzamide |
| SMILES | CCC(=NNC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13Cl3N2O/c1-2-15(10-3-5-11(17)6-4-10)20-21-16(22)13-8-7-12(18)9-14(13)19/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | ZIOZTSXPSPHNJB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|