C18H19ClN2O — CID 3679714
N-[1-(4-chlorophenyl)propylideneamino]-3,4-dimethylbenzamide (PubChem CID 3679714) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)propylideneamino]-3,4-dimethylbenzamide.
| Compound Name | N-[1-(4-chlorophenyl)propylideneamino]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 3679714 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)propylideneamino]-3,4-dimethylbenzamide |
| SMILES | CCC(=NNC(=O)c1ccc(C)c(C)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O/c1-4-17(14-7-9-16(19)10-8-14)20-21-18(22)15-6-5-12(2)13(3)11-15/h5-11H,4H2,1-3H3,(H,21,22) |
| InChIKey | DPZWHUOPZUXYDX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|