C11H11Cl2N3O2 — CID 4181307
N'-[1-(2,4-dichlorophenyl)propylideneamino]oxamide (PubChem CID 4181307) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is N'-[1-(2,4-dichlorophenyl)propylideneamino]oxamide.
| Compound Name | N'-[1-(2,4-dichlorophenyl)propylideneamino]oxamide |
|---|---|
| PubChem CID | 4181307 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N'-[1-(2,4-dichlorophenyl)propylideneamino]oxamide |
| SMILES | CCC(=NNC(=O)C(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O2/c1-2-9(15-16-11(18)10(14)17)7-4-3-6(12)5-8(7)13/h3-5H,2H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | OMLABBWSSKCQBM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|