C13H16Cl2N2O — CID 88673856
N-[1-(2,4-dichlorophenyl)pentylideneamino]acetamide (PubChem CID 88673856) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)pentylideneamino]acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)pentylideneamino]acetamide |
|---|---|
| PubChem CID | 88673856 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)pentylideneamino]acetamide |
| SMILES | CCCCC(=NNC(C)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O/c1-3-4-5-13(17-16-9(2)18)11-7-6-10(14)8-12(11)15/h6-8H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | PFPCPFPQNQOHFK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|