C16H20Cl2O2 — CID 43321487
1-(2,4-dichlorophenyl)decane-1,3-dione (PubChem CID 43321487) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)decane-1,3-dione.
| Compound Name | 1-(2,4-dichlorophenyl)decane-1,3-dione |
|---|---|
| PubChem CID | 43321487 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(2,4-dichlorophenyl)decane-1,3-dione |
| SMILES | CCCCCCCC(=O)CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2O2/c1-2-3-4-5-6-7-13(19)11-16(20)14-9-8-12(17)10-15(14)18/h8-10H,2-7,11H2,1H3 |
| InChIKey | FUWNTCAMBKQNLG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|