methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate

C13H14Cl2O3 — CID 146009606

IUPACmethyl 6-(2,4-dichlorophenyl)-6-oxohexanoate
SMILESCOC(=O)CCCCC(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H14Cl2O3/c1-18-13(17)5-3-2-4-12(16)10-7-6-9(14)8-11(10)15/h6-8H,2-5H2,1H3
InChIKeyCMLJBYKDMWSNSG-UHFFFAOYSA-N
MW289.16 g/mol
LogP3.91
Rot. Bonds6

About methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate

methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate (PubChem CID 146009606) has the molecular formula C13H14Cl2O3 and a molecular weight of 289.16 g/mol. Its IUPAC name is methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate.

Molecular Properties

Compound Namemethyl 6-(2,4-dichlorophenyl)-6-oxohexanoate
PubChem CID146009606
Molecular FormulaC13H14Cl2O3
Molecular Weight289.16 g/mol
Exact Mass288.03
IUPAC Namemethyl 6-(2,4-dichlorophenyl)-6-oxohexanoate
SMILESCOC(=O)CCCCC(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H14Cl2O3/c1-18-13(17)5-3-2-4-12(16)10-7-6-9(14)8-11(10)15/h6-8H,2-5H2,1H3
InChIKeyCMLJBYKDMWSNSG-UHFFFAOYSA-N
XLogP3.91
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.16
LogP ≤ 53.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate?
The IUPAC name of methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate (CID 146009606) is methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate.
What is the SMILES notation for methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate?
The canonical SMILES for methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate is COC(=O)CCCCC(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate?
The InChIKey is CMLJBYKDMWSNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O3/c1-18-13(17)5-3-2-4-12(16)10-7-6-9(14)8-11(10)15/h6-8H,2-5H2,1H3.
What are the key properties of methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate?
methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate has a molecular weight of 289.16 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(2,4-dichlorophenyl)-6-oxohexanoate is sourced from PubChem (CID 146009606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).