C24H34O4 — CID 101015760
1-[4-(3-oxononanoyl)phenyl]nonane-1,3-dione (PubChem CID 101015760) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 1-[4-(3-oxononanoyl)phenyl]nonane-1,3-dione.
| Compound Name | 1-[4-(3-oxononanoyl)phenyl]nonane-1,3-dione |
|---|---|
| PubChem CID | 101015760 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[4-(3-oxononanoyl)phenyl]nonane-1,3-dione |
| SMILES | CCCCCCC(=O)CC(=O)c1ccc(C(=O)CC(=O)CCCCCC)cc1 |
| InChI | InChI=1S/C24H34O4/c1-3-5-7-9-11-21(25)17-23(27)19-13-15-20(16-14-19)24(28)18-22(26)12-10-8-6-4-2/h13-16H,3-12,17-18H2,1-2H3 |
| InChIKey | YYDREQWHRWKZHJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|