C14H17NO4 — CID 43321168
1-(4-nitrophenyl)octane-1,3-dione (PubChem CID 43321168) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 1-(4-nitrophenyl)octane-1,3-dione.
| Compound Name | 1-(4-nitrophenyl)octane-1,3-dione |
|---|---|
| PubChem CID | 43321168 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 1-(4-nitrophenyl)octane-1,3-dione |
| SMILES | CCCCCC(=O)CC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17NO4/c1-2-3-4-5-13(16)10-14(17)11-6-8-12(9-7-11)15(18)19/h6-9H,2-5,10H2,1H3 |
| InChIKey | VESPYLHSVPADTI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|