About S-pentyl 4-nitrobenzenecarbothioate
S-pentyl 4-nitrobenzenecarbothioate (PubChem CID 102257734) has the molecular formula C12H15NO3S
and a molecular weight of 253.32 g/mol. Its IUPAC name is S-pentyl 4-nitrobenzenecarbothioate.
Molecular Properties
| Compound Name | S-pentyl 4-nitrobenzenecarbothioate |
| PubChem CID | 102257734 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | S-pentyl 4-nitrobenzenecarbothioate |
| SMILES | CCCCCSC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15NO3S/c1-2-3-4-9-17-12(14)10-5-7-11(8-6-10)13(15)16/h5-8H,2-4,9H2,1H3 |
| InChIKey | ISRUPEMWBHXGFW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pentyl 4-nitrobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pentyl 4-nitrobenzenecarbothioate?
The IUPAC name of S-pentyl 4-nitrobenzenecarbothioate (CID 102257734) is S-pentyl 4-nitrobenzenecarbothioate.
What is the SMILES notation for S-pentyl 4-nitrobenzenecarbothioate?
The canonical SMILES for S-pentyl 4-nitrobenzenecarbothioate is CCCCCSC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of S-pentyl 4-nitrobenzenecarbothioate?
The InChIKey is ISRUPEMWBHXGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3S/c1-2-3-4-9-17-12(14)10-5-7-11(8-6-10)13(15)16/h5-8H,2-4,9H2,1H3.
What are the key properties of S-pentyl 4-nitrobenzenecarbothioate?
S-pentyl 4-nitrobenzenecarbothioate has a molecular weight of 253.32 g/mol, XLogP of 3.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-pentyl 4-nitrobenzenecarbothioate is sourced from PubChem (CID 102257734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).