C9H6F3NO3S — CID 167061544
S-(2,2,2-trifluoroethyl) 4-nitrobenzenecarbothioate (PubChem CID 167061544) has the molecular formula C9H6F3NO3S and a molecular weight of 265.21 g/mol. Its IUPAC name is S-(2,2,2-trifluoroethyl) 4-nitrobenzenecarbothioate.
| Compound Name | S-(2,2,2-trifluoroethyl) 4-nitrobenzenecarbothioate |
|---|---|
| PubChem CID | 167061544 |
| Molecular Formula | C9H6F3NO3S |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | S-(2,2,2-trifluoroethyl) 4-nitrobenzenecarbothioate |
| SMILES | O=C(SCC(F)(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H6F3NO3S/c10-9(11,12)5-17-8(14)6-1-3-7(4-2-6)13(15)16/h1-4H,5H2 |
| InChIKey | HLCXBAWCNYQGHY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|