About 4-nitrobenzoate;vanadium
4-nitrobenzoate;vanadium (PubChem CID 172712620) has the molecular formula C7H4NO4V-
and a molecular weight of 217.06 g/mol. Its IUPAC name is 4-nitrobenzoate;vanadium.
Molecular Properties
| Compound Name | 4-nitrobenzoate;vanadium |
| PubChem CID | 172712620 |
| Molecular Formula | C7H4NO4V- |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 4-nitrobenzoate;vanadium |
| SMILES | O=C([O-])c1ccc([N+](=O)[O-])cc1.[V] |
| InChI | InChI=1S/C7H5NO4.V/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H,9,10);/p-1 |
| InChIKey | MMBBPTBTALVFKG-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzoate;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzoate;vanadium?
The IUPAC name of 4-nitrobenzoate;vanadium (CID 172712620) is 4-nitrobenzoate;vanadium.
What is the SMILES notation for 4-nitrobenzoate;vanadium?
The canonical SMILES for 4-nitrobenzoate;vanadium is O=C([O-])c1ccc([N+](=O)[O-])cc1.[V].
What is the InChIKey of 4-nitrobenzoate;vanadium?
The InChIKey is MMBBPTBTALVFKG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO4.V/c9-7(10)5-1-3-6(4-2-5)8(11)12;/h1-4H,(H,9,10);/p-1.
What are the key properties of 4-nitrobenzoate;vanadium?
4-nitrobenzoate;vanadium has a molecular weight of 217.06 g/mol, XLogP of -0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzoate;vanadium is sourced from PubChem (CID 172712620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).