C8H3CdNO6 — CID 175010901
cadmium(2+);5-nitrobenzene-1,3-dicarboxylate (PubChem CID 175010901) has the molecular formula C8H3CdNO6 and a molecular weight of 321.53 g/mol. Its IUPAC name is cadmium(2+);5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | cadmium(2+);5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175010901 |
| Molecular Formula | C8H3CdNO6 |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | cadmium(2+);5-nitrobenzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cc(C(=O)[O-])cc([N+](=O)[O-])c1.[Cd+2] |
| InChI | InChI=1S/C8H5NO6.Cd/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;/h1-3H,(H,10,11)(H,12,13);/q;+2/p-2 |
| InChIKey | MONMPKWQTYHPHU-UHFFFAOYSA-L |
| XLogP | -1.68 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|