C8H7N3O5 — CID 165357748
2-amino-1-(3,5-dinitrophenyl)ethanone (PubChem CID 165357748) has the molecular formula C8H7N3O5 and a molecular weight of 225.16 g/mol. Its IUPAC name is 2-amino-1-(3,5-dinitrophenyl)ethanone.
| Compound Name | 2-amino-1-(3,5-dinitrophenyl)ethanone |
|---|---|
| PubChem CID | 165357748 |
| Molecular Formula | C8H7N3O5 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-amino-1-(3,5-dinitrophenyl)ethanone |
| SMILES | NCC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7N3O5/c9-4-8(12)5-1-6(10(13)14)3-7(2-5)11(15)16/h1-3H,4,9H2 |
| InChIKey | YTMYTWBDRNVREW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|