C18H17ClN4O13 — CID 91415518
3,5-dinitrobenzoyl chloride;1-(3,5-dinitrophenyl)-3-hydroxypropan-1-one;ethane-1,2-diol (PubChem CID 91415518) has the molecular formula C18H17ClN4O13 and a molecular weight of 532.80 g/mol. Its IUPAC name is 3,5-dinitrobenzoyl chloride;1-(3,5-dinitrophenyl)-3-hydroxypropan-1-one;ethane-1,2-diol.
| Compound Name | 3,5-dinitrobenzoyl chloride;1-(3,5-dinitrophenyl)-3-hydroxypropan-1-one;ethane-1,2-diol |
|---|---|
| PubChem CID | 91415518 |
| Molecular Formula | C18H17ClN4O13 |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 3,5-dinitrobenzoyl chloride;1-(3,5-dinitrophenyl)-3-hydroxypropan-1-one;ethane-1,2-diol |
| SMILES | O=C(CCO)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.O=C(Cl)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.OCCO |
| InChI | InChI=1S/C9H8N2O6.C7H3ClN2O5.C2H6O2/c12-2-1-9(13)6-3-7(10(14)15)5-8(4-6)11(16)17;8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15;3-1-2-4/h3-5,12H,1-2H2;1-3H;3-4H,1-2H2 |
| InChIKey | WFQGITWVRGZIJZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 267.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|