C14H23Cl2N5O4 — CID 158684921
2,2-bis(aminomethyl)propane-1,3-diamine;methane;5-nitrobenzene-1,3-dicarbonyl chloride (PubChem CID 158684921) has the molecular formula C14H23Cl2N5O4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 2,2-bis(aminomethyl)propane-1,3-diamine;methane;5-nitrobenzene-1,3-dicarbonyl chloride.
| Compound Name | 2,2-bis(aminomethyl)propane-1,3-diamine;methane;5-nitrobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 158684921 |
| Molecular Formula | C14H23Cl2N5O4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2,2-bis(aminomethyl)propane-1,3-diamine;methane;5-nitrobenzene-1,3-dicarbonyl chloride |
| SMILES | C.NCC(CN)(CN)CN.O=C(Cl)c1cc(C(=O)Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H3Cl2NO4.C5H16N4.CH4/c9-7(12)4-1-5(8(10)13)3-6(2-4)11(14)15;6-1-5(2-7,3-8)4-9;/h1-3H;1-4,6-9H2;1H4 |
| InChIKey | IFPPSLFCOJJLQD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 181.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|