About 2,4-dinitroaniline;4-nitrobenzoyl chloride
2,4-dinitroaniline;4-nitrobenzoyl chloride (PubChem CID 161258688) has the molecular formula C13H9ClN4O7
and a molecular weight of 368.69 g/mol. Its IUPAC name is 2,4-dinitroaniline;4-nitrobenzoyl chloride.
Molecular Properties
| Compound Name | 2,4-dinitroaniline;4-nitrobenzoyl chloride |
| PubChem CID | 161258688 |
| Molecular Formula | C13H9ClN4O7 |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2,4-dinitroaniline;4-nitrobenzoyl chloride |
| SMILES | Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C(Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H4ClNO3.C6H5N3O4/c8-7(10)5-1-3-6(4-2-5)9(11)12;7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-4H;1-3H,7H2 |
| InChIKey | VCGPVLHPACEGLT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 172.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitroaniline;4-nitrobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitroaniline;4-nitrobenzoyl chloride?
The IUPAC name of 2,4-dinitroaniline;4-nitrobenzoyl chloride (CID 161258688) is 2,4-dinitroaniline;4-nitrobenzoyl chloride.
What is the SMILES notation for 2,4-dinitroaniline;4-nitrobenzoyl chloride?
The canonical SMILES for 2,4-dinitroaniline;4-nitrobenzoyl chloride is Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C(Cl)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2,4-dinitroaniline;4-nitrobenzoyl chloride?
The InChIKey is VCGPVLHPACEGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3.C6H5N3O4/c8-7(10)5-1-3-6(4-2-5)9(11)12;7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-4H;1-3H,7H2.
What are the key properties of 2,4-dinitroaniline;4-nitrobenzoyl chloride?
2,4-dinitroaniline;4-nitrobenzoyl chloride has a molecular weight of 368.69 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitroaniline;4-nitrobenzoyl chloride is sourced from PubChem (CID 161258688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).