About N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride
N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride (PubChem CID 88763823) has the molecular formula C13H7ClN6O11
and a molecular weight of 458.68 g/mol. Its IUPAC name is N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride.
Molecular Properties
| Compound Name | N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride |
| PubChem CID | 88763823 |
| Molecular Formula | C13H7ClN6O11 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1cccc(N([N+](=O)[O-])[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4ClNO3.C6H3N5O8/c8-7(10)5-1-3-6(4-2-5)9(11)12;12-8(13)5-3-1-2-4(6(5)9(14)15)7(10(16)17)11(18)19/h1-4H;1-3H |
| InChIKey | GLIDWHXGXNKGNN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 236.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride?
The IUPAC name of N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride (CID 88763823) is N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride.
What is the SMILES notation for N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride?
The canonical SMILES for N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride is O=C(Cl)c1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1cccc(N([N+](=O)[O-])[N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride?
The InChIKey is GLIDWHXGXNKGNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3.C6H3N5O8/c8-7(10)5-1-3-6(4-2-5)9(11)12;12-8(13)5-3-1-2-4(6(5)9(14)15)7(10(16)17)11(18)19/h1-4H;1-3H.
What are the key properties of N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride?
N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride has a molecular weight of 458.68 g/mol, XLogP of 2.67, 7 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dinitrophenyl)-N-nitronitramide;4-nitrobenzoyl chloride is sourced from PubChem (CID 88763823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).