C14H6N4O10 — CID 18546886
1,2-bis(2,3-dinitrophenyl)ethane-1,2-dione (PubChem CID 18546886) has the molecular formula C14H6N4O10 and a molecular weight of 390.22 g/mol. Its IUPAC name is 1,2-bis(2,3-dinitrophenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(2,3-dinitrophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 18546886 |
| Molecular Formula | C14H6N4O10 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1,2-bis(2,3-dinitrophenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cccc([N+](=O)[O-])c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H6N4O10/c19-13(7-3-1-5-9(15(21)22)11(7)17(25)26)14(20)8-4-2-6-10(16(23)24)12(8)18(27)28/h1-6H |
| InChIKey | PNSJAXZBWRYQRL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 206.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|