C6H7N5O6 — CID 174855794
hydrazine;1,2,3-trinitrobenzene (PubChem CID 174855794) has the molecular formula C6H7N5O6 and a molecular weight of 245.15 g/mol. Its IUPAC name is hydrazine;1,2,3-trinitrobenzene.
| Compound Name | hydrazine;1,2,3-trinitrobenzene |
|---|---|
| PubChem CID | 174855794 |
| Molecular Formula | C6H7N5O6 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | hydrazine;1,2,3-trinitrobenzene |
| SMILES | NN.O=[N+]([O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N3O6.H4N2/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;1-2/h1-3H;1-2H2 |
| InChIKey | FLPUHPQIAKKIHT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|