About 1-methyl-2,3-dinitrobenzene;hydrate
1-methyl-2,3-dinitrobenzene;hydrate (PubChem CID 86587264) has the molecular formula C7H8N2O5
and a molecular weight of 200.15 g/mol. Its IUPAC name is 1-methyl-2,3-dinitrobenzene;hydrate.
Molecular Properties
| Compound Name | 1-methyl-2,3-dinitrobenzene;hydrate |
| PubChem CID | 86587264 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-methyl-2,3-dinitrobenzene;hydrate |
| SMILES | Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-].O |
| InChI | InChI=1S/C7H6N2O4.H2O/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;/h2-4H,1H3;1H2 |
| InChIKey | VGLBPIYOMXVHCT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 117.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,3-dinitrobenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dinitrobenzene;hydrate?
The IUPAC name of 1-methyl-2,3-dinitrobenzene;hydrate (CID 86587264) is 1-methyl-2,3-dinitrobenzene;hydrate.
What is the SMILES notation for 1-methyl-2,3-dinitrobenzene;hydrate?
The canonical SMILES for 1-methyl-2,3-dinitrobenzene;hydrate is Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-].O.
What is the InChIKey of 1-methyl-2,3-dinitrobenzene;hydrate?
The InChIKey is VGLBPIYOMXVHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O4.H2O/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;/h2-4H,1H3;1H2.
What are the key properties of 1-methyl-2,3-dinitrobenzene;hydrate?
1-methyl-2,3-dinitrobenzene;hydrate has a molecular weight of 200.15 g/mol, XLogP of 0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dinitrobenzene;hydrate is sourced from PubChem (CID 86587264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).