C8H8N2O4 — CID 3916406
1,4-dimethyl-2,3-dinitrobenzene (PubChem CID 3916406) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-dinitrobenzene.
| Compound Name | 1,4-dimethyl-2,3-dinitrobenzene |
|---|---|
| PubChem CID | 3916406 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1,4-dimethyl-2,3-dinitrobenzene |
| SMILES | Cc1ccc(C)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N2O4/c1-5-3-4-6(2)8(10(13)14)7(5)9(11)12/h3-4H,1-2H3 |
| InChIKey | ZCFSWYZFGJAUKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|