C8H8ClNO2 — CID 20508440
1-chloro-2,4-dimethyl-3-nitrobenzene (PubChem CID 20508440) has the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. Its IUPAC name is 1-chloro-2,4-dimethyl-3-nitrobenzene.
| Compound Name | 1-chloro-2,4-dimethyl-3-nitrobenzene |
|---|---|
| PubChem CID | 20508440 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | 1-chloro-2,4-dimethyl-3-nitrobenzene |
| SMILES | Cc1ccc(Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8ClNO2/c1-5-3-4-7(9)6(2)8(5)10(11)12/h3-4H,1-2H3 |
| InChIKey | ADRVFIZSNISDMU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|