C8H8NNaO4S — CID 165453903
sodium 3,6-dimethyl-2-nitrobenzenesulfinate (PubChem CID 165453903) has the molecular formula C8H8NNaO4S and a molecular weight of 237.21 g/mol. Its IUPAC name is sodium 3,6-dimethyl-2-nitrobenzenesulfinate.
| Compound Name | sodium 3,6-dimethyl-2-nitrobenzenesulfinate |
|---|---|
| PubChem CID | 165453903 |
| Molecular Formula | C8H8NNaO4S |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | sodium 3,6-dimethyl-2-nitrobenzenesulfinate |
| SMILES | Cc1ccc(C)c(S(=O)[O-])c1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C8H9NO4S.Na/c1-5-3-4-6(2)8(14(12)13)7(5)9(10)11;/h3-4H,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | LMBPBSAXXXEGNJ-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|