C8H9NaO2S — CID 3310489
sodium 2,5-dimethylbenzenesulfinate (PubChem CID 3310489) has the molecular formula C8H9NaO2S and a molecular weight of 192.22 g/mol. Its IUPAC name is sodium 2,5-dimethylbenzenesulfinate.
| Compound Name | sodium 2,5-dimethylbenzenesulfinate |
|---|---|
| PubChem CID | 3310489 |
| Molecular Formula | C8H9NaO2S |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | sodium 2,5-dimethylbenzenesulfinate |
| SMILES | Cc1ccc(C)c(S(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C8H10O2S.Na/c1-6-3-4-7(2)8(5-6)11(9)10;/h3-5H,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | NHSAAANNKRGWBY-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|