C9H11O2S- — CID 57256835
(2,5-dimethylphenyl)methanesulfinate (PubChem CID 57256835) has the molecular formula C9H11O2S- and a molecular weight of 183.25 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methanesulfinate.
| Compound Name | (2,5-dimethylphenyl)methanesulfinate |
|---|---|
| PubChem CID | 57256835 |
| Molecular Formula | C9H11O2S- |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (2,5-dimethylphenyl)methanesulfinate |
| SMILES | Cc1ccc(C)c(CS(=O)[O-])c1 |
| InChI | InChI=1S/C9H12O2S/c1-7-3-4-8(2)9(5-7)6-12(10)11/h3-5H,6H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | VPKGWCSWTFOPKF-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|