C16H18O4S2Zn — CID 159031464
zinc bis(2,5-dimethylbenzenesulfinate) (PubChem CID 159031464) has the molecular formula C16H18O4S2Zn and a molecular weight of 403.84 g/mol. Its IUPAC name is zinc bis(2,5-dimethylbenzenesulfinate).
| Compound Name | zinc bis(2,5-dimethylbenzenesulfinate) |
|---|---|
| PubChem CID | 159031464 |
| Molecular Formula | C16H18O4S2Zn |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | zinc bis(2,5-dimethylbenzenesulfinate) |
| SMILES | Cc1ccc(C)c(S(=O)[O-])c1.Cc1ccc(C)c(S(=O)[O-])c1.[Zn+2] |
| InChI | InChI=1S/2C8H10O2S.Zn/c2*1-6-3-4-7(2)8(5-6)11(9)10;/h2*3-5H,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | JUYBSQOSZYYVOG-UHFFFAOYSA-L |
| XLogP | 3.08 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|