C8H9O3S- — CID 57159721
(2,4-dimethylphenyl) sulfite (PubChem CID 57159721) has the molecular formula C8H9O3S- and a molecular weight of 185.22 g/mol. Its IUPAC name is (2,4-dimethylphenyl) sulfite.
| Compound Name | (2,4-dimethylphenyl) sulfite |
|---|---|
| PubChem CID | 57159721 |
| Molecular Formula | C8H9O3S- |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | (2,4-dimethylphenyl) sulfite |
| SMILES | Cc1ccc(OS(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)11-12(9)10/h3-5H,1-2H3,(H,9,10)/p-1 |
| InChIKey | VVCJYLMWIMXIFQ-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|